C6H4F5NOS — CID 54209966
[2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]methanol (PubChem CID 54209966) has the molecular formula C6H4F5NOS and a molecular weight of 233.16 g/mol. Its IUPAC name is [2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]methanol.
| Compound Name | [2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 54209966 |
| Molecular Formula | C6H4F5NOS |
| Molecular Weight | 233.16 g/mol |
| Exact Mass | 232.99 |
| IUPAC Name | [2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]methanol |
| SMILES | OCc1csc(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C6H4F5NOS/c7-5(8,6(9,10)11)4-12-3(1-13)2-14-4/h2,13H,1H2 |
| InChIKey | PVGNLHPSXAODSN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|