C16H19FN4O4S — CID 54210128
4-[[4-[bis(2-hydroxyethyl)amino]-2-fluorophenyl]diazenyl]benzenesulfonamide (PubChem CID 54210128) has the molecular formula C16H19FN4O4S and a molecular weight of 382.42 g/mol. Its IUPAC name is 4-[[4-[bis(2-hydroxyethyl)amino]-2-fluorophenyl]diazenyl]benzenesulfonamide.
| Compound Name | 4-[[4-[bis(2-hydroxyethyl)amino]-2-fluorophenyl]diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54210128 |
| Molecular Formula | C16H19FN4O4S |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-[[4-[bis(2-hydroxyethyl)amino]-2-fluorophenyl]diazenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=N/c2ccc(N(CCO)CCO)cc2F)cc1 |
| InChI | InChI=1S/C16H19FN4O4S/c17-15-11-13(21(7-9-22)8-10-23)3-6-16(15)20-19-12-1-4-14(5-2-12)26(18,24)25/h1-6,11,22-23H,7-10H2,(H2,18,24,25)/b20-19+ |
| InChIKey | PVJFZVQKBUADHH-FMQUCBEESA-N |
| XLogP | 1.68 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|