C24H33ClO5 — CID 54210208
4-[[(3R,8S,9R,10S,13S,14S)-9-chloro-10,13-dimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]-2-hydroxy-2-methyl-4-oxobutanoic acid (PubChem CID 54210208) has the molecular formula C24H33ClO5 and a molecular weight of 436.98 g/mol. Its IUPAC name is 4-[[(3R,8S,9R,10S,13S,14S)-9-chloro-10,13-dimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]-2-hydroxy-2-methyl-4-oxobutanoic acid.
| Compound Name | 4-[[(3R,8S,9R,10S,13S,14S)-9-chloro-10,13-dimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]-2-hydroxy-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54210208 |
| Molecular Formula | C24H33ClO5 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 4-[[(3R,8S,9R,10S,13S,14S)-9-chloro-10,13-dimethyl-3,6,7,8,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]-2-hydroxy-2-methyl-4-oxobutanoic acid |
| SMILES | CC(O)(CC(=O)O[C@@H]1C=C[C@@]2(C)C(=C1)CC[C@H]1[C@@H]3CCC[C@@]3(C)CC[C@@]12Cl)C(=O)O |
| InChI | InChI=1S/C24H33ClO5/c1-21-9-4-5-17(21)18-7-6-15-13-16(30-19(26)14-23(3,29)20(27)28)8-10-22(15,2)24(18,25)12-11-21/h8,10,13,16-18,29H,4-7,9,11-12,14H2,1-3H3,(H,27,28)/t16-,17+,18+,21+,22+,23?,24-/m1/s1 |
| InChIKey | PVKQPFTXEAVAEG-CSAYRFTBSA-N |
| XLogP | 4.61 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|