C20H30F4O2 — CID 54211034
2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]-6,6-difluoro-5-methyl-2,3-dihydropyran (PubChem CID 54211034) has the molecular formula C20H30F4O2 and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]-6,6-difluoro-5-methyl-2,3-dihydropyran.
| Compound Name | 2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]-6,6-difluoro-5-methyl-2,3-dihydropyran |
|---|---|
| PubChem CID | 54211034 |
| Molecular Formula | C20H30F4O2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 2-[4-[difluoro-(4-methylcyclohexyl)methoxy]cyclohexyl]-6,6-difluoro-5-methyl-2,3-dihydropyran |
| SMILES | CC1=CCC(C2CCC(OC(F)(F)C3CCC(C)CC3)CC2)OC1(F)F |
| InChI | InChI=1S/C20H30F4O2/c1-13-3-8-16(9-4-13)20(23,24)25-17-10-6-15(7-11-17)18-12-5-14(2)19(21,22)26-18/h5,13,15-18H,3-4,6-12H2,1-2H3 |
| InChIKey | PVYUMHUYNYNDOM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|