C19F12O6 — CID 54211299
4,5,6-trifluoro-7-[1,2,2,3,3,3-hexafluoro-1-(5,6,7-trifluoro-1,3-dioxo-2-benzofuran-4-yl)propyl]-2-benzofuran-1,3-dione (PubChem CID 54211299) has the molecular formula C19F12O6 and a molecular weight of 552.18 g/mol. Its IUPAC name is 4,5,6-trifluoro-7-[1,2,2,3,3,3-hexafluoro-1-(5,6,7-trifluoro-1,3-dioxo-2-benzofuran-4-yl)propyl]-2-benzofuran-1,3-dione.
| Compound Name | 4,5,6-trifluoro-7-[1,2,2,3,3,3-hexafluoro-1-(5,6,7-trifluoro-1,3-dioxo-2-benzofuran-4-yl)propyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 54211299 |
| Molecular Formula | C19F12O6 |
| Molecular Weight | 552.18 g/mol |
| Exact Mass | 551.95 |
| IUPAC Name | 4,5,6-trifluoro-7-[1,2,2,3,3,3-hexafluoro-1-(5,6,7-trifluoro-1,3-dioxo-2-benzofuran-4-yl)propyl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2c1c(F)c(F)c(F)c2C(F)(c1c(F)c(F)c(F)c2c1C(=O)OC2=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19F12O6/c20-7-3-1(13(32)36-15(3)34)5(9(22)11(7)24)17(26,18(27,28)19(29,30)31)6-2-4(16(35)37-14(2)33)8(21)12(25)10(6)23 |
| InChIKey | PWDGLZBLOFVVNR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.18 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|