C16H27FO3 — CID 54212127
(3aR,4R,6aS)-6a-[(3R,4R)-4-fluoro-3-hydroxyoctyl]-4-methyl-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one (PubChem CID 54212127) has the molecular formula C16H27FO3 and a molecular weight of 286.39 g/mol. Its IUPAC name is (3aR,4R,6aS)-6a-[(3R,4R)-4-fluoro-3-hydroxyoctyl]-4-methyl-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,6aS)-6a-[(3R,4R)-4-fluoro-3-hydroxyoctyl]-4-methyl-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 54212127 |
| Molecular Formula | C16H27FO3 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (3aR,4R,6aS)-6a-[(3R,4R)-4-fluoro-3-hydroxyoctyl]-4-methyl-3a,4,5,6-tetrahydro-3H-cyclopenta[b]furan-2-one |
| SMILES | CCCC[C@@H](F)[C@H](O)CC[C@@]12CC[C@@H](C)[C@H]1CC(=O)O2 |
| InChI | InChI=1S/C16H27FO3/c1-3-4-5-13(17)14(18)7-9-16-8-6-11(2)12(16)10-15(19)20-16/h11-14,18H,3-10H2,1-2H3/t11-,12-,13-,14-,16+/m1/s1 |
| InChIKey | PWQUHLURPKUPKP-PAURTPPISA-N |
| XLogP | 3.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |