About [1-amino-3-(2-oxo-1,3-oxazolidin-3-yl)propylidene]urea
[1-amino-3-(2-oxo-1,3-oxazolidin-3-yl)propylidene]urea (PubChem CID 54212253) has the molecular formula C7H12N4O3
and a molecular weight of 200.20 g/mol. Its IUPAC name is [1-amino-3-(2-oxo-1,3-oxazolidin-3-yl)propylidene]urea.
Molecular Properties
| Compound Name | [1-amino-3-(2-oxo-1,3-oxazolidin-3-yl)propylidene]urea |
| PubChem CID | 54212253 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | [1-amino-3-(2-oxo-1,3-oxazolidin-3-yl)propylidene]urea |
| SMILES | NC(=O)N=C(N)CCN1CCOC1=O |
| InChI | InChI=1S/C7H12N4O3/c8-5(10-6(9)12)1-2-11-3-4-14-7(11)13/h1-4H2,(H4,8,9,10,12) |
| InChIKey | PWSVLFNCSFCTIS-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [1-amino-3-(2-oxo-1,3-oxazolidin-3-yl)propylidene]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-amino-3-(2-oxo-1,3-oxazolidin-3-yl)propylidene]urea?
The IUPAC name of [1-amino-3-(2-oxo-1,3-oxazolidin-3-yl)propylidene]urea (CID 54212253) is [1-amino-3-(2-oxo-1,3-oxazolidin-3-yl)propylidene]urea.
What is the SMILES notation for [1-amino-3-(2-oxo-1,3-oxazolidin-3-yl)propylidene]urea?
The canonical SMILES for [1-amino-3-(2-oxo-1,3-oxazolidin-3-yl)propylidene]urea is NC(=O)N=C(N)CCN1CCOC1=O.
What is the InChIKey of [1-amino-3-(2-oxo-1,3-oxazolidin-3-yl)propylidene]urea?
The InChIKey is PWSVLFNCSFCTIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O3/c8-5(10-6(9)12)1-2-11-3-4-14-7(11)13/h1-4H2,(H4,8,9,10,12).
What are the key properties of [1-amino-3-(2-oxo-1,3-oxazolidin-3-yl)propylidene]urea?
[1-amino-3-(2-oxo-1,3-oxazolidin-3-yl)propylidene]urea has a molecular weight of 200.20 g/mol, XLogP of -0.74, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-amino-3-(2-oxo-1,3-oxazolidin-3-yl)propylidene]urea is sourced from PubChem (CID 54212253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).