C23H29NO3 — CID 54212561
5-methoxy-2-[2-(4-methylphenyl)ethyl]-4-pentoxyisoindol-1-ol (PubChem CID 54212561) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is 5-methoxy-2-[2-(4-methylphenyl)ethyl]-4-pentoxyisoindol-1-ol.
| Compound Name | 5-methoxy-2-[2-(4-methylphenyl)ethyl]-4-pentoxyisoindol-1-ol |
|---|---|
| PubChem CID | 54212561 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 5-methoxy-2-[2-(4-methylphenyl)ethyl]-4-pentoxyisoindol-1-ol |
| SMILES | CCCCCOc1c(OC)ccc2c(O)n(CCc3ccc(C)cc3)cc12 |
| InChI | InChI=1S/C23H29NO3/c1-4-5-6-15-27-22-20-16-24(14-13-18-9-7-17(2)8-10-18)23(25)19(20)11-12-21(22)26-3/h7-12,16,25H,4-6,13-15H2,1-3H3 |
| InChIKey | PWXXFROEAZWDQF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|