C20H36O3 — CID 54212969
cyclopropylmethyl 11-methoxy-3,7,11-trimethyldodec-2-enoate (PubChem CID 54212969) has the molecular formula C20H36O3 and a molecular weight of 324.50 g/mol. Its IUPAC name is cyclopropylmethyl 11-methoxy-3,7,11-trimethyldodec-2-enoate.
| Compound Name | cyclopropylmethyl 11-methoxy-3,7,11-trimethyldodec-2-enoate |
|---|---|
| PubChem CID | 54212969 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | cyclopropylmethyl 11-methoxy-3,7,11-trimethyldodec-2-enoate |
| SMILES | COC(C)(C)CCCC(C)CCCC(C)=CC(=O)OCC1CC1 |
| InChI | InChI=1S/C20H36O3/c1-16(10-7-13-20(3,4)22-5)8-6-9-17(2)14-19(21)23-15-18-11-12-18/h14,16,18H,6-13,15H2,1-5H3 |
| InChIKey | PXFAVVOZDSEMNE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|