About 2H-1,5-benzodiazepine
2H-1,5-benzodiazepine (PubChem CID 54213230) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is 2H-1,5-benzodiazepine.
Molecular Properties
| Compound Name | 2H-1,5-benzodiazepine |
| PubChem CID | 54213230 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 2H-1,5-benzodiazepine |
| SMILES | C1=CN=c2ccccc2=NC1 |
| InChI | InChI=1S/C9H8N2/c1-2-5-9-8(4-1)10-6-3-7-11-9/h1-6H,7H2 |
| InChIKey | PXJOZBAAIGZSDU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-1,5-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,5-benzodiazepine?
The IUPAC name of 2H-1,5-benzodiazepine (CID 54213230) is 2H-1,5-benzodiazepine.
What is the SMILES notation for 2H-1,5-benzodiazepine?
The canonical SMILES for 2H-1,5-benzodiazepine is C1=CN=c2ccccc2=NC1.
What is the InChIKey of 2H-1,5-benzodiazepine?
The InChIKey is PXJOZBAAIGZSDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2/c1-2-5-9-8(4-1)10-6-3-7-11-9/h1-6H,7H2.
What are the key properties of 2H-1,5-benzodiazepine?
2H-1,5-benzodiazepine has a molecular weight of 144.18 g/mol, XLogP of 0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,5-benzodiazepine is sourced from PubChem (CID 54213230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).