About O-(2-aminoethyl) ethanethioate
O-(2-aminoethyl) ethanethioate (PubChem CID 54213374) has the molecular formula C4H9NOS
and a molecular weight of 119.19 g/mol. Its IUPAC name is O-(2-aminoethyl) ethanethioate.
Molecular Properties
| Compound Name | O-(2-aminoethyl) ethanethioate |
| PubChem CID | 54213374 |
| Molecular Formula | C4H9NOS |
| Molecular Weight | 119.19 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | O-(2-aminoethyl) ethanethioate |
| SMILES | CC(=S)OCCN |
| InChI | InChI=1S/C4H9NOS/c1-4(7)6-3-2-5/h2-3,5H2,1H3 |
| InChIKey | PXLYHNNSVSMRNY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2-aminoethyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2-aminoethyl) ethanethioate?
The IUPAC name of O-(2-aminoethyl) ethanethioate (CID 54213374) is O-(2-aminoethyl) ethanethioate.
What is the SMILES notation for O-(2-aminoethyl) ethanethioate?
The canonical SMILES for O-(2-aminoethyl) ethanethioate is CC(=S)OCCN.
What is the InChIKey of O-(2-aminoethyl) ethanethioate?
The InChIKey is PXLYHNNSVSMRNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NOS/c1-4(7)6-3-2-5/h2-3,5H2,1H3.
What are the key properties of O-(2-aminoethyl) ethanethioate?
O-(2-aminoethyl) ethanethioate has a molecular weight of 119.19 g/mol, XLogP of 0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2-aminoethyl) ethanethioate is sourced from PubChem (CID 54213374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).