About 2-[2-(diethylamino)ethyl-methylamino]ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate
2-[2-(diethylamino)ethyl-methylamino]ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate (PubChem CID 54213460) has the molecular formula C49H97N3O4
and a molecular weight of 792.33 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethyl-methylamino]ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate.
Molecular Properties
| Compound Name | 2-[2-(diethylamino)ethyl-methylamino]ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate |
| PubChem CID | 54213460 |
| Molecular Formula | C49H97N3O4 |
| Molecular Weight | 792.33 g/mol |
| Exact Mass | 791.75 |
| IUPAC Name | 2-[2-(diethylamino)ethyl-methylamino]ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate |
| SMILES | CCCCCCCCC=CCCCCCCCCOCC(CNC(=O)OCCN(C)CCN(CC)CC)OCCCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C49H97N3O4/c1-6-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-43-54-47-48(46-50-49(53)56-45-42-51(5)40-41-52(8-3)9-4)55-44-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-7-2/h22-25,48H,6-21,26-47H2,1-5H3,(H,50,53) |
| InChIKey | PXNOFAQPKZLPJA-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 792.33 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(diethylamino)ethyl-methylamino]ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(diethylamino)ethyl-methylamino]ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate?
The IUPAC name of 2-[2-(diethylamino)ethyl-methylamino]ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate (CID 54213460) is 2-[2-(diethylamino)ethyl-methylamino]ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate.
What is the SMILES notation for 2-[2-(diethylamino)ethyl-methylamino]ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate?
The canonical SMILES for 2-[2-(diethylamino)ethyl-methylamino]ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate is CCCCCCCCC=CCCCCCCCCOCC(CNC(=O)OCCN(C)CCN(CC)CC)OCCCCCCCCC=CCCCCCCCC.
What is the InChIKey of 2-[2-(diethylamino)ethyl-methylamino]ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate?
The InChIKey is PXNOFAQPKZLPJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C49H97N3O4/c1-6-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-43-54-47-48(46-50-49(53)56-45-42-51(5)40-41-52(8-3)9-4)55-44-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-7-2/h22-25,48H,6-21,26-47H2,1-5H3,(H,50,53).
What are the key properties of 2-[2-(diethylamino)ethyl-methylamino]ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate?
2-[2-(diethylamino)ethyl-methylamino]ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate has a molecular weight of 792.33 g/mol, XLogP of 13.46, 45 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(diethylamino)ethyl-methylamino]ethyl N-[2,3-bis(octadec-9-enoxy)propyl]carbamate is sourced from PubChem (CID 54213460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).