About 6-amino-2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine-7-carbonitrile
6-amino-2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine-7-carbonitrile (PubChem CID 54213695) has the molecular formula C15H14N4
and a molecular weight of 250.31 g/mol. Its IUPAC name is 6-amino-2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine-7-carbonitrile.
Molecular Properties
| Compound Name | 6-amino-2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine-7-carbonitrile |
| PubChem CID | 54213695 |
| Molecular Formula | C15H14N4 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 6-amino-2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine-7-carbonitrile |
| SMILES | N#Cc1c(N)ncc2c1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C15H14N4/c16-6-13-14-10-19(8-11-4-2-1-3-5-11)9-12(14)7-18-15(13)17/h1-5,7H,8-10H2,(H2,17,18) |
| InChIKey | PXQULCJABTYAJK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine-7-carbonitrile?
The IUPAC name of 6-amino-2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine-7-carbonitrile (CID 54213695) is 6-amino-2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine-7-carbonitrile.
What is the SMILES notation for 6-amino-2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine-7-carbonitrile?
The canonical SMILES for 6-amino-2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine-7-carbonitrile is N#Cc1c(N)ncc2c1CN(Cc1ccccc1)C2.
What is the InChIKey of 6-amino-2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine-7-carbonitrile?
The InChIKey is PXQULCJABTYAJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4/c16-6-13-14-10-19(8-11-4-2-1-3-5-11)9-12(14)7-18-15(13)17/h1-5,7H,8-10H2,(H2,17,18).
What are the key properties of 6-amino-2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine-7-carbonitrile?
6-amino-2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine-7-carbonitrile has a molecular weight of 250.31 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-benzyl-1,3-dihydropyrrolo[3,4-c]pyridine-7-carbonitrile is sourced from PubChem (CID 54213695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).