C34H38N2O5S — CID 54213741
4-cyano-N-[3-[1-[2,4-dioxo-6-(2-phenylethyl)-6-propyloxan-3-yl]-2,2-dimethylpropyl]phenyl]benzenesulfonamide (PubChem CID 54213741) has the molecular formula C34H38N2O5S and a molecular weight of 586.75 g/mol. Its IUPAC name is 4-cyano-N-[3-[1-[2,4-dioxo-6-(2-phenylethyl)-6-propyloxan-3-yl]-2,2-dimethylpropyl]phenyl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[3-[1-[2,4-dioxo-6-(2-phenylethyl)-6-propyloxan-3-yl]-2,2-dimethylpropyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54213741 |
| Molecular Formula | C34H38N2O5S |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | 4-cyano-N-[3-[1-[2,4-dioxo-6-(2-phenylethyl)-6-propyloxan-3-yl]-2,2-dimethylpropyl]phenyl]benzenesulfonamide |
| SMILES | CCCC1(CCc2ccccc2)CC(=O)C(C(c2cccc(NS(=O)(=O)c3ccc(C#N)cc3)c2)C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C34H38N2O5S/c1-5-19-34(20-18-24-10-7-6-8-11-24)22-29(37)30(32(38)41-34)31(33(2,3)4)26-12-9-13-27(21-26)36-42(39,40)28-16-14-25(23-35)15-17-28/h6-17,21,30-31,36H,5,18-20,22H2,1-4H3 |
| InChIKey | PXROUKPMNXLKMG-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|