About bis(prop-2-enyl) 2-(2-amino-2-ethoxyethyl)-2-morpholin-4-ylpropanedioate
bis(prop-2-enyl) 2-(2-amino-2-ethoxyethyl)-2-morpholin-4-ylpropanedioate (PubChem CID 54214318) has the molecular formula C17H28N2O6
and a molecular weight of 356.42 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-(2-amino-2-ethoxyethyl)-2-morpholin-4-ylpropanedioate.
Molecular Properties
| Compound Name | bis(prop-2-enyl) 2-(2-amino-2-ethoxyethyl)-2-morpholin-4-ylpropanedioate |
| PubChem CID | 54214318 |
| Molecular Formula | C17H28N2O6 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | bis(prop-2-enyl) 2-(2-amino-2-ethoxyethyl)-2-morpholin-4-ylpropanedioate |
| SMILES | C=CCOC(=O)C(CC(N)OCC)(C(=O)OCC=C)N1CCOCC1 |
| InChI | InChI=1S/C17H28N2O6/c1-4-9-24-15(20)17(13-14(18)23-6-3,16(21)25-10-5-2)19-7-11-22-12-8-19/h4-5,14H,1-2,6-13,18H2,3H3 |
| InChIKey | PYBSBLDENIEZJK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(prop-2-enyl) 2-(2-amino-2-ethoxyethyl)-2-morpholin-4-ylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(prop-2-enyl) 2-(2-amino-2-ethoxyethyl)-2-morpholin-4-ylpropanedioate?
The IUPAC name of bis(prop-2-enyl) 2-(2-amino-2-ethoxyethyl)-2-morpholin-4-ylpropanedioate (CID 54214318) is bis(prop-2-enyl) 2-(2-amino-2-ethoxyethyl)-2-morpholin-4-ylpropanedioate.
What is the SMILES notation for bis(prop-2-enyl) 2-(2-amino-2-ethoxyethyl)-2-morpholin-4-ylpropanedioate?
The canonical SMILES for bis(prop-2-enyl) 2-(2-amino-2-ethoxyethyl)-2-morpholin-4-ylpropanedioate is C=CCOC(=O)C(CC(N)OCC)(C(=O)OCC=C)N1CCOCC1.
What is the InChIKey of bis(prop-2-enyl) 2-(2-amino-2-ethoxyethyl)-2-morpholin-4-ylpropanedioate?
The InChIKey is PYBSBLDENIEZJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O6/c1-4-9-24-15(20)17(13-14(18)23-6-3,16(21)25-10-5-2)19-7-11-22-12-8-19/h4-5,14H,1-2,6-13,18H2,3H3.
What are the key properties of bis(prop-2-enyl) 2-(2-amino-2-ethoxyethyl)-2-morpholin-4-ylpropanedioate?
bis(prop-2-enyl) 2-(2-amino-2-ethoxyethyl)-2-morpholin-4-ylpropanedioate has a molecular weight of 356.42 g/mol, XLogP of 0.23, 11 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(prop-2-enyl) 2-(2-amino-2-ethoxyethyl)-2-morpholin-4-ylpropanedioate is sourced from PubChem (CID 54214318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).