C40H34Si — CID 54214405
1,1-dimethyl-3,4-bis(3-methylphenyl)-2,5-dinaphthalen-1-ylsilole (PubChem CID 54214405) has the molecular formula C40H34Si and a molecular weight of 542.80 g/mol. Its IUPAC name is 1,1-dimethyl-3,4-bis(3-methylphenyl)-2,5-dinaphthalen-1-ylsilole.
| Compound Name | 1,1-dimethyl-3,4-bis(3-methylphenyl)-2,5-dinaphthalen-1-ylsilole |
|---|---|
| PubChem CID | 54214405 |
| Molecular Formula | C40H34Si |
| Molecular Weight | 542.80 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 1,1-dimethyl-3,4-bis(3-methylphenyl)-2,5-dinaphthalen-1-ylsilole |
| SMILES | Cc1cccc(C2=C(c3cccc4ccccc34)[Si](C)(C)C(c3cccc4ccccc34)=C2c2cccc(C)c2)c1 |
| InChI | InChI=1S/C40H34Si/c1-27-13-9-19-31(25-27)37-38(32-20-10-14-28(2)26-32)40(36-24-12-18-30-16-6-8-22-34(30)36)41(3,4)39(37)35-23-11-17-29-15-5-7-21-33(29)35/h5-26H,1-4H3 |
| InChIKey | PYDLTTOYEUSRFO-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.80 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|