About (4-methylphenyl) 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate
(4-methylphenyl) 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate (PubChem CID 54215235) has the molecular formula C29H30O2
and a molecular weight of 410.56 g/mol. Its IUPAC name is (4-methylphenyl) 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate.
Molecular Properties
| Compound Name | (4-methylphenyl) 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate |
| PubChem CID | 54215235 |
| Molecular Formula | C29H30O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (4-methylphenyl) 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate |
| SMILES | CC1=C(C=Cc2ccc3cc(C(=O)Oc4ccc(C)cc4)ccc3c2)C(C)(C)CCC1 |
| InChI | InChI=1S/C29H30O2/c1-20-7-14-26(15-8-20)31-28(30)25-13-12-23-18-22(9-11-24(23)19-25)10-16-27-21(2)6-5-17-29(27,3)4/h7-16,18-19H,5-6,17H2,1-4H3 |
| InChIKey | PYSAOZJBSUVBAJ-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate?
The IUPAC name of (4-methylphenyl) 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate (CID 54215235) is (4-methylphenyl) 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate.
What is the SMILES notation for (4-methylphenyl) 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate?
The canonical SMILES for (4-methylphenyl) 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate is CC1=C(C=Cc2ccc3cc(C(=O)Oc4ccc(C)cc4)ccc3c2)C(C)(C)CCC1.
What is the InChIKey of (4-methylphenyl) 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate?
The InChIKey is PYSAOZJBSUVBAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H30O2/c1-20-7-14-26(15-8-20)31-28(30)25-13-12-23-18-22(9-11-24(23)19-25)10-16-27-21(2)6-5-17-29(27,3)4/h7-16,18-19H,5-6,17H2,1-4H3.
What are the key properties of (4-methylphenyl) 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate?
(4-methylphenyl) 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate has a molecular weight of 410.56 g/mol, XLogP of 7.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylate is sourced from PubChem (CID 54215235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).