About 2-methylbutan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethyl carbonate
2-methylbutan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethyl carbonate (PubChem CID 54215487) has the molecular formula C13H19NO6
and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-methylbutan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethyl carbonate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethyl carbonate |
| PubChem CID | 54215487 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-methylbutan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethyl carbonate |
| SMILES | CCC(C)(C)OOC(=O)OCCN1C(=O)C=C(C)C1=O |
| InChI | InChI=1S/C13H19NO6/c1-5-13(3,4)20-19-12(17)18-7-6-14-10(15)8-9(2)11(14)16/h8H,5-7H2,1-4H3 |
| InChIKey | PYWWIUBGWFYYJH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethyl carbonate?
The IUPAC name of 2-methylbutan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethyl carbonate (CID 54215487) is 2-methylbutan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethyl carbonate.
What is the SMILES notation for 2-methylbutan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethyl carbonate?
The canonical SMILES for 2-methylbutan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethyl carbonate is CCC(C)(C)OOC(=O)OCCN1C(=O)C=C(C)C1=O.
What is the InChIKey of 2-methylbutan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethyl carbonate?
The InChIKey is PYWWIUBGWFYYJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO6/c1-5-13(3,4)20-19-12(17)18-7-6-14-10(15)8-9(2)11(14)16/h8H,5-7H2,1-4H3.
What are the key properties of 2-methylbutan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethyl carbonate?
2-methylbutan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethyl carbonate has a molecular weight of 285.30 g/mol, XLogP of 1.57, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yloxy 2-(3-methyl-2,5-dioxopyrrol-1-yl)ethyl carbonate is sourced from PubChem (CID 54215487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).