About 5-ethylhept-2-yne
5-ethylhept-2-yne (PubChem CID 54215545) has the molecular formula C9H16
and a molecular weight of 124.23 g/mol. Its IUPAC name is 5-ethylhept-2-yne.
Molecular Properties
| Compound Name | 5-ethylhept-2-yne |
| PubChem CID | 54215545 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | 5-ethylhept-2-yne |
| SMILES | CC#CCC(CC)CC |
| InChI | InChI=1S/C9H16/c1-4-7-8-9(5-2)6-3/h9H,5-6,8H2,1-3H3 |
| InChIKey | LNBNVQGJYNVPIZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylhept-2-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylhept-2-yne?
The IUPAC name of 5-ethylhept-2-yne (CID 54215545) is 5-ethylhept-2-yne.
What is the SMILES notation for 5-ethylhept-2-yne?
The canonical SMILES for 5-ethylhept-2-yne is CC#CCC(CC)CC.
What is the InChIKey of 5-ethylhept-2-yne?
The InChIKey is LNBNVQGJYNVPIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16/c1-4-7-8-9(5-2)6-3/h9H,5-6,8H2,1-3H3.
What are the key properties of 5-ethylhept-2-yne?
5-ethylhept-2-yne has a molecular weight of 124.23 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylhept-2-yne is sourced from PubChem (CID 54215545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).