About methyl 9-(2-methoxy-2-oxoethylidene)-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate
methyl 9-(2-methoxy-2-oxoethylidene)-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate (PubChem CID 54215838) has the molecular formula C14H16N2O5
and a molecular weight of 292.29 g/mol. Its IUPAC name is methyl 9-(2-methoxy-2-oxoethylidene)-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 9-(2-methoxy-2-oxoethylidene)-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate |
| PubChem CID | 54215838 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | methyl 9-(2-methoxy-2-oxoethylidene)-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate |
| SMILES | COC(=O)C=C1CCC(C)n2c1ncc(C(=O)OC)c2=O |
| InChI | InChI=1S/C14H16N2O5/c1-8-4-5-9(6-11(17)20-2)12-15-7-10(14(19)21-3)13(18)16(8)12/h6-8H,4-5H2,1-3H3 |
| InChIKey | PZCUEQKVLHNLNG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 9-(2-methoxy-2-oxoethylidene)-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-(2-methoxy-2-oxoethylidene)-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate?
The IUPAC name of methyl 9-(2-methoxy-2-oxoethylidene)-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate (CID 54215838) is methyl 9-(2-methoxy-2-oxoethylidene)-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate.
What is the SMILES notation for methyl 9-(2-methoxy-2-oxoethylidene)-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate?
The canonical SMILES for methyl 9-(2-methoxy-2-oxoethylidene)-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate is COC(=O)C=C1CCC(C)n2c1ncc(C(=O)OC)c2=O.
What is the InChIKey of methyl 9-(2-methoxy-2-oxoethylidene)-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate?
The InChIKey is PZCUEQKVLHNLNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O5/c1-8-4-5-9(6-11(17)20-2)12-15-7-10(14(19)21-3)13(18)16(8)12/h6-8H,4-5H2,1-3H3.
What are the key properties of methyl 9-(2-methoxy-2-oxoethylidene)-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate?
methyl 9-(2-methoxy-2-oxoethylidene)-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate has a molecular weight of 292.29 g/mol, XLogP of 0.94, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-(2-methoxy-2-oxoethylidene)-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate is sourced from PubChem (CID 54215838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).