6-aminohexa-2,4-dienoic acid

C6H9NO2 — CID 54217253

IUPAC6-aminohexa-2,4-dienoic acid
SMILESNCC=CC=CC(=O)O
InChIInChI=1S/C6H9NO2/c7-5-3-1-2-4-6(8)9/h1-4H,5,7H2,(H,8,9)
InChIKeyQABSVNGMVHOAKF-UHFFFAOYSA-N
MW127.14 g/mol
LogP0.14
Rot. Bonds3

About 6-aminohexa-2,4-dienoic acid

6-aminohexa-2,4-dienoic acid (PubChem CID 54217253) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 6-aminohexa-2,4-dienoic acid.

Molecular Properties

Compound Name6-aminohexa-2,4-dienoic acid
PubChem CID54217253
Molecular FormulaC6H9NO2
Molecular Weight127.14 g/mol
Exact Mass127.06
IUPAC Name6-aminohexa-2,4-dienoic acid
SMILESNCC=CC=CC(=O)O
InChIInChI=1S/C6H9NO2/c7-5-3-1-2-4-6(8)9/h1-4H,5,7H2,(H,8,9)
InChIKeyQABSVNGMVHOAKF-UHFFFAOYSA-N
XLogP0.14
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500127.14
LogP ≤ 50.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 6-aminohexa-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-aminohexa-2,4-dienoic acid?
The IUPAC name of 6-aminohexa-2,4-dienoic acid (CID 54217253) is 6-aminohexa-2,4-dienoic acid.
What is the SMILES notation for 6-aminohexa-2,4-dienoic acid?
The canonical SMILES for 6-aminohexa-2,4-dienoic acid is NCC=CC=CC(=O)O.
What is the InChIKey of 6-aminohexa-2,4-dienoic acid?
The InChIKey is QABSVNGMVHOAKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c7-5-3-1-2-4-6(8)9/h1-4H,5,7H2,(H,8,9).
What are the key properties of 6-aminohexa-2,4-dienoic acid?
6-aminohexa-2,4-dienoic acid has a molecular weight of 127.14 g/mol, XLogP of 0.14, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-aminohexa-2,4-dienoic acid is sourced from PubChem (CID 54217253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).