About 3-[(1S,2S)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide
3-[(1S,2S)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide (PubChem CID 54217706) has the molecular formula C14H18N2O2S2
and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-[(1S,2S)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide.
Molecular Properties
| Compound Name | 3-[(1S,2S)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide |
| PubChem CID | 54217706 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 3-[(1S,2S)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide |
| SMILES | CNC(=S)[C@@]1(c2cccc(C(N)=O)c2)CCCC[S@@]1=O |
| InChI | InChI=1S/C14H18N2O2S2/c1-16-13(19)14(7-2-3-8-20(14)18)11-6-4-5-10(9-11)12(15)17/h4-6,9H,2-3,7-8H2,1H3,(H2,15,17)(H,16,19)/t14-,20-/m0/s1 |
| InChIKey | QAJDGAOJHVOWTI-XOBRGWDASA-N |
| XLogP | 1.46 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1S,2S)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S,2S)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide?
The IUPAC name of 3-[(1S,2S)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide (CID 54217706) is 3-[(1S,2S)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide.
What is the SMILES notation for 3-[(1S,2S)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide?
The canonical SMILES for 3-[(1S,2S)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide is CNC(=S)[C@@]1(c2cccc(C(N)=O)c2)CCCC[S@@]1=O.
What is the InChIKey of 3-[(1S,2S)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide?
The InChIKey is QAJDGAOJHVOWTI-XOBRGWDASA-N. The full InChI is InChI=1S/C14H18N2O2S2/c1-16-13(19)14(7-2-3-8-20(14)18)11-6-4-5-10(9-11)12(15)17/h4-6,9H,2-3,7-8H2,1H3,(H2,15,17)(H,16,19)/t14-,20-/m0/s1.
What are the key properties of 3-[(1S,2S)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide?
3-[(1S,2S)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide has a molecular weight of 310.44 g/mol, XLogP of 1.46, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S,2S)-2-(methylcarbamothioyl)-1-oxothian-2-yl]benzamide is sourced from PubChem (CID 54217706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).