About prop-2-enyl 2-methoxyacetate
prop-2-enyl 2-methoxyacetate (PubChem CID 542179) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is prop-2-enyl 2-methoxyacetate.
Molecular Properties
| Compound Name | prop-2-enyl 2-methoxyacetate |
| PubChem CID | 542179 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | prop-2-enyl 2-methoxyacetate |
| SMILES | C=CCOC(=O)COC |
| InChI | InChI=1S/C6H10O3/c1-3-4-9-6(7)5-8-2/h3H,1,4-5H2,2H3 |
| InChIKey | QCXOXQDMZZKKIS-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2-methoxyacetate?
The IUPAC name of prop-2-enyl 2-methoxyacetate (CID 542179) is prop-2-enyl 2-methoxyacetate.
What is the SMILES notation for prop-2-enyl 2-methoxyacetate?
The canonical SMILES for prop-2-enyl 2-methoxyacetate is C=CCOC(=O)COC.
What is the InChIKey of prop-2-enyl 2-methoxyacetate?
The InChIKey is QCXOXQDMZZKKIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3/c1-3-4-9-6(7)5-8-2/h3H,1,4-5H2,2H3.
What are the key properties of prop-2-enyl 2-methoxyacetate?
prop-2-enyl 2-methoxyacetate has a molecular weight of 130.14 g/mol, XLogP of 0.36, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2-methoxyacetate is sourced from PubChem (CID 542179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).