C30H37N5O13 — CID 54218246
(4S)-4-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-carboxypropanoyl]-(4-methyl-2-oxochromen-3-yl)amino]-5-oxopentanoic acid (PubChem CID 54218246) has the molecular formula C30H37N5O13 and a molecular weight of 675.65 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-carboxypropanoyl]-(4-methyl-2-oxochromen-3-yl)amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-carboxypropanoyl]-(4-methyl-2-oxochromen-3-yl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54218246 |
| Molecular Formula | C30H37N5O13 |
| Molecular Weight | 675.65 g/mol |
| Exact Mass | 675.24 |
| IUPAC Name | (4S)-4-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-carboxypropanoyl]-(4-methyl-2-oxochromen-3-yl)amino]-5-oxopentanoic acid |
| SMILES | CC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N(C(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)C(C)C)c1c(C)c2ccccc2oc1=O |
| InChI | InChI=1S/C30H37N5O13/c1-13(2)24(31)27(44)34-19(12-23(41)42)29(46)35(25-14(3)16-7-5-6-8-20(16)48-30(25)47)28(45)17(9-10-21(37)38)33-26(43)18(11-22(39)40)32-15(4)36/h5-8,13,17-19,24H,9-12,31H2,1-4H3,(H,32,36)(H,33,43)(H,34,44)(H,37,38)(H,39,40)(H,41,42)/t17-,18-,19-,24-/m0/s1 |
| InChIKey | QARYVZWIFWLXSV-LYXWCMDISA-N |
| XLogP | -0.77 |
| TPSA | 292.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.65 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|