C12H10F7NO2 — CID 54218345
2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1,2-oxazolidin-5-ol (PubChem CID 54218345) has the molecular formula C12H10F7NO2 and a molecular weight of 333.20 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1,2-oxazolidin-5-ol.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1,2-oxazolidin-5-ol |
|---|---|
| PubChem CID | 54218345 |
| Molecular Formula | C12H10F7NO2 |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1,2-oxazolidin-5-ol |
| SMILES | OC1CC(c2ccccc2)N(C(F)(F)C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C12H10F7NO2/c13-10(14,11(15,16)17)12(18,19)20-8(6-9(21)22-20)7-4-2-1-3-5-7/h1-5,8-9,21H,6H2 |
| InChIKey | QATKQVKQIPQAQG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|