C28H52O6SSi2 — CID 54218465
[(2R,3R,4R)-6-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-1,1-dimethoxy-3,4-dimethylhex-5-en-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 54218465) has the molecular formula C28H52O6SSi2 and a molecular weight of 572.96 g/mol. Its IUPAC name is [(2R,3R,4R)-6-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-1,1-dimethoxy-3,4-dimethylhex-5-en-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,4R)-6-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-1,1-dimethoxy-3,4-dimethylhex-5-en-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 54218465 |
| Molecular Formula | C28H52O6SSi2 |
| Molecular Weight | 572.96 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | [(2R,3R,4R)-6-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-1,1-dimethoxy-3,4-dimethylhex-5-en-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COC(OC)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](C)C(=CS(=O)(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H52O6SSi2/c1-21(22(2)25(26(31-9)32-10)34-37(13,14)28(6,7)8)24(33-36(11,12)27(3,4)5)20-35(29,30)23-18-16-15-17-19-23/h15-22,25-26H,1-14H3/t21-,22-,25-/m1/s1 |
| InChIKey | QAVFULUEQXONBU-TZBSWOFLSA-N |
| XLogP | 7.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.96 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|