About 2-(4-amino-1,3-thiazol-2-yl)-2-oxoacetaldehyde
2-(4-amino-1,3-thiazol-2-yl)-2-oxoacetaldehyde (PubChem CID 54218559) has the molecular formula C5H4N2O2S
and a molecular weight of 156.17 g/mol. Its IUPAC name is 2-(4-amino-1,3-thiazol-2-yl)-2-oxoacetaldehyde.
Molecular Properties
| Compound Name | 2-(4-amino-1,3-thiazol-2-yl)-2-oxoacetaldehyde |
| PubChem CID | 54218559 |
| Molecular Formula | C5H4N2O2S |
| Molecular Weight | 156.17 g/mol |
| Exact Mass | 156.00 |
| IUPAC Name | 2-(4-amino-1,3-thiazol-2-yl)-2-oxoacetaldehyde |
| SMILES | Nc1csc(C(=O)C=O)n1 |
| InChI | InChI=1S/C5H4N2O2S/c6-4-2-10-5(7-4)3(9)1-8/h1-2H,6H2 |
| InChIKey | XULAPMQHDYBMLF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.17 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-amino-1,3-thiazol-2-yl)-2-oxoacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-1,3-thiazol-2-yl)-2-oxoacetaldehyde?
The IUPAC name of 2-(4-amino-1,3-thiazol-2-yl)-2-oxoacetaldehyde (CID 54218559) is 2-(4-amino-1,3-thiazol-2-yl)-2-oxoacetaldehyde.
What is the SMILES notation for 2-(4-amino-1,3-thiazol-2-yl)-2-oxoacetaldehyde?
The canonical SMILES for 2-(4-amino-1,3-thiazol-2-yl)-2-oxoacetaldehyde is Nc1csc(C(=O)C=O)n1.
What is the InChIKey of 2-(4-amino-1,3-thiazol-2-yl)-2-oxoacetaldehyde?
The InChIKey is XULAPMQHDYBMLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2S/c6-4-2-10-5(7-4)3(9)1-8/h1-2H,6H2.
What are the key properties of 2-(4-amino-1,3-thiazol-2-yl)-2-oxoacetaldehyde?
2-(4-amino-1,3-thiazol-2-yl)-2-oxoacetaldehyde has a molecular weight of 156.17 g/mol, XLogP of 0.11, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-1,3-thiazol-2-yl)-2-oxoacetaldehyde is sourced from PubChem (CID 54218559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).