About 5-iminohex-2-enedioic acid
5-iminohex-2-enedioic acid (PubChem CID 54218649) has the molecular formula C6H7NO4
and a molecular weight of 157.12 g/mol. Its IUPAC name is 5-iminohex-2-enedioic acid.
Molecular Properties
| Compound Name | 5-iminohex-2-enedioic acid |
| PubChem CID | 54218649 |
| Molecular Formula | C6H7NO4 |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 5-iminohex-2-enedioic acid |
| SMILES | [H]/N=C(\CC=CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H7NO4/c7-4(6(10)11)2-1-3-5(8)9/h1,3,7H,2H2,(H,8,9)(H,10,11)/b3-1?,7-4+ |
| InChIKey | QAYXQINRLLPSSR-FGGFPXJISA-N |
| XLogP | 0.12 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-iminohex-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iminohex-2-enedioic acid?
The IUPAC name of 5-iminohex-2-enedioic acid (CID 54218649) is 5-iminohex-2-enedioic acid.
What is the SMILES notation for 5-iminohex-2-enedioic acid?
The canonical SMILES for 5-iminohex-2-enedioic acid is [H]/N=C(\CC=CC(=O)O)C(=O)O.
What is the InChIKey of 5-iminohex-2-enedioic acid?
The InChIKey is QAYXQINRLLPSSR-FGGFPXJISA-N. The full InChI is InChI=1S/C6H7NO4/c7-4(6(10)11)2-1-3-5(8)9/h1,3,7H,2H2,(H,8,9)(H,10,11)/b3-1?,7-4+.
What are the key properties of 5-iminohex-2-enedioic acid?
5-iminohex-2-enedioic acid has a molecular weight of 157.12 g/mol, XLogP of 0.12, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iminohex-2-enedioic acid is sourced from PubChem (CID 54218649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).