C24H29N3O3 — CID 54218707
N-[4-[4-[benzyl(methyl)amino]piperidine-1-carbonyl]phenyl]-3-methoxyprop-2-enamide (PubChem CID 54218707) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-[4-[4-[benzyl(methyl)amino]piperidine-1-carbonyl]phenyl]-3-methoxyprop-2-enamide.
| Compound Name | N-[4-[4-[benzyl(methyl)amino]piperidine-1-carbonyl]phenyl]-3-methoxyprop-2-enamide |
|---|---|
| PubChem CID | 54218707 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-[4-[4-[benzyl(methyl)amino]piperidine-1-carbonyl]phenyl]-3-methoxyprop-2-enamide |
| SMILES | COC=CC(=O)Nc1ccc(C(=O)N2CCC(N(C)Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H29N3O3/c1-26(18-19-6-4-3-5-7-19)22-12-15-27(16-13-22)24(29)20-8-10-21(11-9-20)25-23(28)14-17-30-2/h3-11,14,17,22H,12-13,15-16,18H2,1-2H3,(H,25,28) |
| InChIKey | QBAAWPKDTKVSCU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|