About [2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]methanol
[2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]methanol (PubChem CID 54218781) has the molecular formula C19H20N4O7
and a molecular weight of 416.39 g/mol. Its IUPAC name is [2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]methanol.
Molecular Properties
| Compound Name | [2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]methanol |
| PubChem CID | 54218781 |
| Molecular Formula | C19H20N4O7 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | [2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]methanol |
| SMILES | COc1cc(OC)nc(Oc2cccc(Oc3nc(OC)cc(OC)n3)c2CO)n1 |
| InChI | InChI=1S/C19H20N4O7/c1-25-14-8-15(26-2)21-18(20-14)29-12-6-5-7-13(11(12)10-24)30-19-22-16(27-3)9-17(23-19)28-4/h5-9,24H,10H2,1-4H3 |
| InChIKey | QBBILWMRJVAGRF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze [2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]methanol?
The IUPAC name of [2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]methanol (CID 54218781) is [2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]methanol.
What is the SMILES notation for [2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]methanol?
The canonical SMILES for [2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]methanol is COc1cc(OC)nc(Oc2cccc(Oc3nc(OC)cc(OC)n3)c2CO)n1.
What is the InChIKey of [2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]methanol?
The InChIKey is QBBILWMRJVAGRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O7/c1-25-14-8-15(26-2)21-18(20-14)29-12-6-5-7-13(11(12)10-24)30-19-22-16(27-3)9-17(23-19)28-4/h5-9,24H,10H2,1-4H3.
What are the key properties of [2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]methanol?
[2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]methanol has a molecular weight of 416.39 g/mol, XLogP of 2.38, 9 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]phenyl]methanol is sourced from PubChem (CID 54218781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).