2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid

C6H3F3N2O4 — CID 54219144

IUPAC2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid
SMILESO=C(O)c1cc(=O)[nH]c(=O)n1C(F)(F)F
InChIInChI=1S/C6H3F3N2O4/c7-6(8,9)11-2(4(13)14)1-3(12)10-5(11)15/h1H,(H,13,14)(H,10,12,15)
InChIKeyQBHLJIHFTYKPEF-UHFFFAOYSA-N
MW224.09 g/mol
LogP-0.29
Rot. Bonds1

About 2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid

2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid (PubChem CID 54219144) has the molecular formula C6H3F3N2O4 and a molecular weight of 224.09 g/mol. Its IUPAC name is 2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid.

Molecular Properties

Compound Name2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid
PubChem CID54219144
Molecular FormulaC6H3F3N2O4
Molecular Weight224.09 g/mol
Exact Mass224.00
IUPAC Name2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid
SMILESO=C(O)c1cc(=O)[nH]c(=O)n1C(F)(F)F
InChIInChI=1S/C6H3F3N2O4/c7-6(8,9)11-2(4(13)14)1-3(12)10-5(11)15/h1H,(H,13,14)(H,10,12,15)
InChIKeyQBHLJIHFTYKPEF-UHFFFAOYSA-N
XLogP-0.29
TPSA92.16 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.09
LogP ≤ 5-0.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid?
The IUPAC name of 2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid (CID 54219144) is 2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid.
What is the SMILES notation for 2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid?
The canonical SMILES for 2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid is O=C(O)c1cc(=O)[nH]c(=O)n1C(F)(F)F.
What is the InChIKey of 2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid?
The InChIKey is QBHLJIHFTYKPEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F3N2O4/c7-6(8,9)11-2(4(13)14)1-3(12)10-5(11)15/h1H,(H,13,14)(H,10,12,15).
What are the key properties of 2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid?
2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid has a molecular weight of 224.09 g/mol, XLogP of -0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dioxo-3-(trifluoromethyl)pyrimidine-4-carboxylic acid is sourced from PubChem (CID 54219144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).