About propan-2-yl 2-methoxyacetate
propan-2-yl 2-methoxyacetate (PubChem CID 542192) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is propan-2-yl 2-methoxyacetate.
Molecular Properties
| Compound Name | propan-2-yl 2-methoxyacetate |
| PubChem CID | 542192 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | propan-2-yl 2-methoxyacetate |
| SMILES | COCC(=O)OC(C)C |
| InChI | InChI=1S/C6H12O3/c1-5(2)9-6(7)4-8-3/h5H,4H2,1-3H3 |
| InChIKey | XYXFJNIUUWEUIJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-methoxyacetate?
The IUPAC name of propan-2-yl 2-methoxyacetate (CID 542192) is propan-2-yl 2-methoxyacetate.
What is the SMILES notation for propan-2-yl 2-methoxyacetate?
The canonical SMILES for propan-2-yl 2-methoxyacetate is COCC(=O)OC(C)C.
What is the InChIKey of propan-2-yl 2-methoxyacetate?
The InChIKey is XYXFJNIUUWEUIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3/c1-5(2)9-6(7)4-8-3/h5H,4H2,1-3H3.
What are the key properties of propan-2-yl 2-methoxyacetate?
propan-2-yl 2-methoxyacetate has a molecular weight of 132.16 g/mol, XLogP of 0.58, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-methoxyacetate is sourced from PubChem (CID 542192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).