About propan-2-yl 2-(4,5-dimethylimidazol-1-yl)acetate
propan-2-yl 2-(4,5-dimethylimidazol-1-yl)acetate (PubChem CID 54219397) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is propan-2-yl 2-(4,5-dimethylimidazol-1-yl)acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-(4,5-dimethylimidazol-1-yl)acetate |
| PubChem CID | 54219397 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | propan-2-yl 2-(4,5-dimethylimidazol-1-yl)acetate |
| SMILES | Cc1ncn(CC(=O)OC(C)C)c1C |
| InChI | InChI=1S/C10H16N2O2/c1-7(2)14-10(13)5-12-6-11-8(3)9(12)4/h6-7H,5H2,1-4H3 |
| InChIKey | XDSZUNCTSHVKLH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl 2-(4,5-dimethylimidazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-(4,5-dimethylimidazol-1-yl)acetate?
The IUPAC name of propan-2-yl 2-(4,5-dimethylimidazol-1-yl)acetate (CID 54219397) is propan-2-yl 2-(4,5-dimethylimidazol-1-yl)acetate.
What is the SMILES notation for propan-2-yl 2-(4,5-dimethylimidazol-1-yl)acetate?
The canonical SMILES for propan-2-yl 2-(4,5-dimethylimidazol-1-yl)acetate is Cc1ncn(CC(=O)OC(C)C)c1C.
What is the InChIKey of propan-2-yl 2-(4,5-dimethylimidazol-1-yl)acetate?
The InChIKey is XDSZUNCTSHVKLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-7(2)14-10(13)5-12-6-11-8(3)9(12)4/h6-7H,5H2,1-4H3.
What are the key properties of propan-2-yl 2-(4,5-dimethylimidazol-1-yl)acetate?
propan-2-yl 2-(4,5-dimethylimidazol-1-yl)acetate has a molecular weight of 196.25 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(4,5-dimethylimidazol-1-yl)acetate is sourced from PubChem (CID 54219397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).