About 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]benzaldehyde
3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]benzaldehyde (PubChem CID 54219494) has the molecular formula C19H25NO
and a molecular weight of 283.42 g/mol. Its IUPAC name is 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]benzaldehyde.
Molecular Properties
| Compound Name | 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]benzaldehyde |
| PubChem CID | 54219494 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]benzaldehyde |
| SMILES | CCN(CC=CC#CC(C)(C)C)Cc1cccc(C=O)c1 |
| InChI | InChI=1S/C19H25NO/c1-5-20(13-8-6-7-12-19(2,3)4)15-17-10-9-11-18(14-17)16-21/h6,8-11,14,16H,5,13,15H2,1-4H3 |
| InChIKey | QBOHGSHMAPDGDE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]benzaldehyde?
The IUPAC name of 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]benzaldehyde (CID 54219494) is 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]benzaldehyde.
What is the SMILES notation for 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]benzaldehyde?
The canonical SMILES for 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]benzaldehyde is CCN(CC=CC#CC(C)(C)C)Cc1cccc(C=O)c1.
What is the InChIKey of 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]benzaldehyde?
The InChIKey is QBOHGSHMAPDGDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO/c1-5-20(13-8-6-7-12-19(2,3)4)15-17-10-9-11-18(14-17)16-21/h6,8-11,14,16H,5,13,15H2,1-4H3.
What are the key properties of 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]benzaldehyde?
3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]benzaldehyde has a molecular weight of 283.42 g/mol, XLogP of 3.93, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[6,6-dimethylhept-2-en-4-ynyl(ethyl)amino]methyl]benzaldehyde is sourced from PubChem (CID 54219494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).