About 2-(3,7-dimethylocta-2,6-dienoxymethyl)oxirane
2-(3,7-dimethylocta-2,6-dienoxymethyl)oxirane (PubChem CID 54219619) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,6-dienoxymethyl)oxirane.
Molecular Properties
| Compound Name | 2-(3,7-dimethylocta-2,6-dienoxymethyl)oxirane |
| PubChem CID | 54219619 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-(3,7-dimethylocta-2,6-dienoxymethyl)oxirane |
| SMILES | CC(C)=CCCC(C)=CCOCC1CO1 |
| InChI | InChI=1S/C13H22O2/c1-11(2)5-4-6-12(3)7-8-14-9-13-10-15-13/h5,7,13H,4,6,8-10H2,1-3H3 |
| InChIKey | QBQKOBUUPXWVSE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,7-dimethylocta-2,6-dienoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,7-dimethylocta-2,6-dienoxymethyl)oxirane?
The IUPAC name of 2-(3,7-dimethylocta-2,6-dienoxymethyl)oxirane (CID 54219619) is 2-(3,7-dimethylocta-2,6-dienoxymethyl)oxirane.
What is the SMILES notation for 2-(3,7-dimethylocta-2,6-dienoxymethyl)oxirane?
The canonical SMILES for 2-(3,7-dimethylocta-2,6-dienoxymethyl)oxirane is CC(C)=CCCC(C)=CCOCC1CO1.
What is the InChIKey of 2-(3,7-dimethylocta-2,6-dienoxymethyl)oxirane?
The InChIKey is QBQKOBUUPXWVSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-11(2)5-4-6-12(3)7-8-14-9-13-10-15-13/h5,7,13H,4,6,8-10H2,1-3H3.
What are the key properties of 2-(3,7-dimethylocta-2,6-dienoxymethyl)oxirane?
2-(3,7-dimethylocta-2,6-dienoxymethyl)oxirane has a molecular weight of 210.32 g/mol, XLogP of 3.09, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,7-dimethylocta-2,6-dienoxymethyl)oxirane is sourced from PubChem (CID 54219619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).