About 2-(4-tricyclo[5.2.1.02,6]decanyloxy)ethanol
2-(4-tricyclo[5.2.1.02,6]decanyloxy)ethanol (PubChem CID 54219899) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-(4-tricyclo[5.2.1.02,6]decanyloxy)ethanol.
Molecular Properties
| Compound Name | 2-(4-tricyclo[5.2.1.02,6]decanyloxy)ethanol |
| PubChem CID | 54219899 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 2-(4-tricyclo[5.2.1.02,6]decanyloxy)ethanol |
| SMILES | OCCOC1CC2C3CCC(C3)C2C1 |
| InChI | InChI=1S/C12H20O2/c13-3-4-14-10-6-11-8-1-2-9(5-8)12(11)7-10/h8-13H,1-7H2 |
| InChIKey | QBVGWYJMLIERHM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-tricyclo[5.2.1.02,6]decanyloxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tricyclo[5.2.1.02,6]decanyloxy)ethanol?
The IUPAC name of 2-(4-tricyclo[5.2.1.02,6]decanyloxy)ethanol (CID 54219899) is 2-(4-tricyclo[5.2.1.02,6]decanyloxy)ethanol.
What is the SMILES notation for 2-(4-tricyclo[5.2.1.02,6]decanyloxy)ethanol?
The canonical SMILES for 2-(4-tricyclo[5.2.1.02,6]decanyloxy)ethanol is OCCOC1CC2C3CCC(C3)C2C1.
What is the InChIKey of 2-(4-tricyclo[5.2.1.02,6]decanyloxy)ethanol?
The InChIKey is QBVGWYJMLIERHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c13-3-4-14-10-6-11-8-1-2-9(5-8)12(11)7-10/h8-13H,1-7H2.
What are the key properties of 2-(4-tricyclo[5.2.1.02,6]decanyloxy)ethanol?
2-(4-tricyclo[5.2.1.02,6]decanyloxy)ethanol has a molecular weight of 196.29 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tricyclo[5.2.1.02,6]decanyloxy)ethanol is sourced from PubChem (CID 54219899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).