C14H22O — CID 54220026
6,6-dimethyl-2,3a,4,5,5a,7,8,9-octahydro-1H-benzo[e][1]benzofuran (PubChem CID 54220026) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 6,6-dimethyl-2,3a,4,5,5a,7,8,9-octahydro-1H-benzo[e][1]benzofuran.
| Compound Name | 6,6-dimethyl-2,3a,4,5,5a,7,8,9-octahydro-1H-benzo[e][1]benzofuran |
|---|---|
| PubChem CID | 54220026 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 6,6-dimethyl-2,3a,4,5,5a,7,8,9-octahydro-1H-benzo[e][1]benzofuran |
| SMILES | CC1(C)CCCC2=C3CCOC3CCC21 |
| InChI | InChI=1S/C14H22O/c1-14(2)8-3-4-10-11-7-9-15-13(11)6-5-12(10)14/h12-13H,3-9H2,1-2H3 |
| InChIKey | QBXRFADBBMFVMR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|