About 3-chloro-5,6-dihydrobenzo[b][1,4]benzothiazepine
3-chloro-5,6-dihydrobenzo[b][1,4]benzothiazepine (PubChem CID 54220110) has the molecular formula C13H10ClNS
and a molecular weight of 247.75 g/mol. Its IUPAC name is 3-chloro-5,6-dihydrobenzo[b][1,4]benzothiazepine.
Molecular Properties
| Compound Name | 3-chloro-5,6-dihydrobenzo[b][1,4]benzothiazepine |
| PubChem CID | 54220110 |
| Molecular Formula | C13H10ClNS |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 3-chloro-5,6-dihydrobenzo[b][1,4]benzothiazepine |
| SMILES | Clc1ccc2c(c1)NCc1ccccc1S2 |
| InChI | InChI=1S/C13H10ClNS/c14-10-5-6-13-11(7-10)15-8-9-3-1-2-4-12(9)16-13/h1-7,15H,8H2 |
| InChIKey | QBZDKLJHMHENBG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-5,6-dihydrobenzo[b][1,4]benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5,6-dihydrobenzo[b][1,4]benzothiazepine?
The IUPAC name of 3-chloro-5,6-dihydrobenzo[b][1,4]benzothiazepine (CID 54220110) is 3-chloro-5,6-dihydrobenzo[b][1,4]benzothiazepine.
What is the SMILES notation for 3-chloro-5,6-dihydrobenzo[b][1,4]benzothiazepine?
The canonical SMILES for 3-chloro-5,6-dihydrobenzo[b][1,4]benzothiazepine is Clc1ccc2c(c1)NCc1ccccc1S2.
What is the InChIKey of 3-chloro-5,6-dihydrobenzo[b][1,4]benzothiazepine?
The InChIKey is QBZDKLJHMHENBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClNS/c14-10-5-6-13-11(7-10)15-8-9-3-1-2-4-12(9)16-13/h1-7,15H,8H2.
What are the key properties of 3-chloro-5,6-dihydrobenzo[b][1,4]benzothiazepine?
3-chloro-5,6-dihydrobenzo[b][1,4]benzothiazepine has a molecular weight of 247.75 g/mol, XLogP of 4.42, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5,6-dihydrobenzo[b][1,4]benzothiazepine is sourced from PubChem (CID 54220110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).