About methyl 2-ethyl-5-nitrobenzoate
methyl 2-ethyl-5-nitrobenzoate (PubChem CID 54220219) has the molecular formula C10H11NO4
and a molecular weight of 209.20 g/mol. Its IUPAC name is methyl 2-ethyl-5-nitrobenzoate.
Molecular Properties
| Compound Name | methyl 2-ethyl-5-nitrobenzoate |
| PubChem CID | 54220219 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | methyl 2-ethyl-5-nitrobenzoate |
| SMILES | CCc1ccc([N+](=O)[O-])cc1C(=O)OC |
| InChI | InChI=1S/C10H11NO4/c1-3-7-4-5-8(11(13)14)6-9(7)10(12)15-2/h4-6H,3H2,1-2H3 |
| InChIKey | QCBAWUWFMSIGNL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-ethyl-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethyl-5-nitrobenzoate?
The IUPAC name of methyl 2-ethyl-5-nitrobenzoate (CID 54220219) is methyl 2-ethyl-5-nitrobenzoate.
What is the SMILES notation for methyl 2-ethyl-5-nitrobenzoate?
The canonical SMILES for methyl 2-ethyl-5-nitrobenzoate is CCc1ccc([N+](=O)[O-])cc1C(=O)OC.
What is the InChIKey of methyl 2-ethyl-5-nitrobenzoate?
The InChIKey is QCBAWUWFMSIGNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4/c1-3-7-4-5-8(11(13)14)6-9(7)10(12)15-2/h4-6H,3H2,1-2H3.
What are the key properties of methyl 2-ethyl-5-nitrobenzoate?
methyl 2-ethyl-5-nitrobenzoate has a molecular weight of 209.20 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-5-nitrobenzoate is sourced from PubChem (CID 54220219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).