C10H13F3N6S — CID 54220720
1-[1-(4-cyanobutyl)-1,2,4-triazol-3-yl]-3-(2,2,2-trifluoroethyl)thiourea (PubChem CID 54220720) has the molecular formula C10H13F3N6S and a molecular weight of 306.32 g/mol. Its IUPAC name is 1-[1-(4-cyanobutyl)-1,2,4-triazol-3-yl]-3-(2,2,2-trifluoroethyl)thiourea.
| Compound Name | 1-[1-(4-cyanobutyl)-1,2,4-triazol-3-yl]-3-(2,2,2-trifluoroethyl)thiourea |
|---|---|
| PubChem CID | 54220720 |
| Molecular Formula | C10H13F3N6S |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1-[1-(4-cyanobutyl)-1,2,4-triazol-3-yl]-3-(2,2,2-trifluoroethyl)thiourea |
| SMILES | N#CCCCCn1cnc(NC(=S)NCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N6S/c11-10(12,13)6-15-9(20)17-8-16-7-19(18-8)5-3-1-2-4-14/h7H,1-3,5-6H2,(H2,15,17,18,20) |
| InChIKey | QCJWLNRCSYEKAQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 78.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|