About 4-(trifluoromethyl)-1,3-benzodiazepine-2-thione
4-(trifluoromethyl)-1,3-benzodiazepine-2-thione (PubChem CID 54220801) has the molecular formula C10H5F3N2S
and a molecular weight of 242.23 g/mol. Its IUPAC name is 4-(trifluoromethyl)-1,3-benzodiazepine-2-thione.
Molecular Properties
| Compound Name | 4-(trifluoromethyl)-1,3-benzodiazepine-2-thione |
| PubChem CID | 54220801 |
| Molecular Formula | C10H5F3N2S |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 4-(trifluoromethyl)-1,3-benzodiazepine-2-thione |
| SMILES | FC(F)(F)c1cc2ccccc2nc(=S)n1 |
| InChI | InChI=1S/C10H5F3N2S/c11-10(12,13)8-5-6-3-1-2-4-7(6)14-9(16)15-8/h1-5H |
| InChIKey | QCLKEAJTPLEPNU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(trifluoromethyl)-1,3-benzodiazepine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(trifluoromethyl)-1,3-benzodiazepine-2-thione?
The IUPAC name of 4-(trifluoromethyl)-1,3-benzodiazepine-2-thione (CID 54220801) is 4-(trifluoromethyl)-1,3-benzodiazepine-2-thione.
What is the SMILES notation for 4-(trifluoromethyl)-1,3-benzodiazepine-2-thione?
The canonical SMILES for 4-(trifluoromethyl)-1,3-benzodiazepine-2-thione is FC(F)(F)c1cc2ccccc2nc(=S)n1.
What is the InChIKey of 4-(trifluoromethyl)-1,3-benzodiazepine-2-thione?
The InChIKey is QCLKEAJTPLEPNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F3N2S/c11-10(12,13)8-5-6-3-1-2-4-7(6)14-9(16)15-8/h1-5H.
What are the key properties of 4-(trifluoromethyl)-1,3-benzodiazepine-2-thione?
4-(trifluoromethyl)-1,3-benzodiazepine-2-thione has a molecular weight of 242.23 g/mol, XLogP of 3.38, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(trifluoromethyl)-1,3-benzodiazepine-2-thione is sourced from PubChem (CID 54220801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).