About prop-2-ynyl 2-formyloxyacetate
prop-2-ynyl 2-formyloxyacetate (PubChem CID 54221202) has the molecular formula C6H6O4
and a molecular weight of 142.11 g/mol. Its IUPAC name is prop-2-ynyl 2-formyloxyacetate.
Molecular Properties
| Compound Name | prop-2-ynyl 2-formyloxyacetate |
| PubChem CID | 54221202 |
| Molecular Formula | C6H6O4 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | prop-2-ynyl 2-formyloxyacetate |
| SMILES | C#CCOC(=O)COC=O |
| InChI | InChI=1S/C6H6O4/c1-2-3-10-6(8)4-9-5-7/h1,5H,3-4H2 |
| InChIKey | ZMWBDYHYCHHBHP-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 2-formyloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 2-formyloxyacetate?
The IUPAC name of prop-2-ynyl 2-formyloxyacetate (CID 54221202) is prop-2-ynyl 2-formyloxyacetate.
What is the SMILES notation for prop-2-ynyl 2-formyloxyacetate?
The canonical SMILES for prop-2-ynyl 2-formyloxyacetate is C#CCOC(=O)COC=O.
What is the InChIKey of prop-2-ynyl 2-formyloxyacetate?
The InChIKey is ZMWBDYHYCHHBHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O4/c1-2-3-10-6(8)4-9-5-7/h1,5H,3-4H2.
What are the key properties of prop-2-ynyl 2-formyloxyacetate?
prop-2-ynyl 2-formyloxyacetate has a molecular weight of 142.11 g/mol, XLogP of -0.66, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 2-formyloxyacetate is sourced from PubChem (CID 54221202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).