C36H67N7O10 — CID 54221560
tert-butyl N-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoacetyl]amino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate (PubChem CID 54221560) has the molecular formula C36H67N7O10 and a molecular weight of 757.97 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoacetyl]amino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoacetyl]amino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 54221560 |
| Molecular Formula | C36H67N7O10 |
| Molecular Weight | 757.97 g/mol |
| Exact Mass | 757.49 |
| IUPAC Name | tert-butyl N-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoacetyl]amino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN(CCCCNC(=O)C(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H67N7O10/c1-33(2,3)50-29(46)40-23-19-25-43(32(49)53-36(10,11)12)24-18-17-21-38-27(45)26(44)37-20-15-13-14-16-22-39-28(41-30(47)51-34(4,5)6)42-31(48)52-35(7,8)9/h13-25H2,1-12H3,(H,37,44)(H,38,45)(H,40,46)(H2,39,41,42,47,48) |
| InChIKey | QCYAWLWWJAEZQV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 215.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.97 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|