About methyl 6-aminooxyiminocyclohexa-1,3-diene-1-carboxylate
methyl 6-aminooxyiminocyclohexa-1,3-diene-1-carboxylate (PubChem CID 54221646) has the molecular formula C8H10N2O3
and a molecular weight of 182.18 g/mol. Its IUPAC name is methyl 6-aminooxyiminocyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 6-aminooxyiminocyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 54221646 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | methyl 6-aminooxyiminocyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC=CCC1=NON |
| InChI | InChI=1S/C8H10N2O3/c1-12-8(11)6-4-2-3-5-7(6)10-13-9/h2-4H,5,9H2,1H3 |
| InChIKey | QCZQHKDEWVGVLS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-aminooxyiminocyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-aminooxyiminocyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of methyl 6-aminooxyiminocyclohexa-1,3-diene-1-carboxylate (CID 54221646) is methyl 6-aminooxyiminocyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl 6-aminooxyiminocyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for methyl 6-aminooxyiminocyclohexa-1,3-diene-1-carboxylate is COC(=O)C1=CC=CCC1=NON.
What is the InChIKey of methyl 6-aminooxyiminocyclohexa-1,3-diene-1-carboxylate?
The InChIKey is QCZQHKDEWVGVLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c1-12-8(11)6-4-2-3-5-7(6)10-13-9/h2-4H,5,9H2,1H3.
What are the key properties of methyl 6-aminooxyiminocyclohexa-1,3-diene-1-carboxylate?
methyl 6-aminooxyiminocyclohexa-1,3-diene-1-carboxylate has a molecular weight of 182.18 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-aminooxyiminocyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 54221646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).