C19H18F6N8O4 — CID 54222094
2-N-[2-[amino-[2-(hydrazinecarbonyl)benzoyl]amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene-1,2-dicarbohydrazide (PubChem CID 54222094) has the molecular formula C19H18F6N8O4 and a molecular weight of 536.39 g/mol. Its IUPAC name is 2-N-[2-[amino-[2-(hydrazinecarbonyl)benzoyl]amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene-1,2-dicarbohydrazide.
| Compound Name | 2-N-[2-[amino-[2-(hydrazinecarbonyl)benzoyl]amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene-1,2-dicarbohydrazide |
|---|---|
| PubChem CID | 54222094 |
| Molecular Formula | C19H18F6N8O4 |
| Molecular Weight | 536.39 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 2-N-[2-[amino-[2-(hydrazinecarbonyl)benzoyl]amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene-1,2-dicarbohydrazide |
| SMILES | NNC(=O)c1ccccc1C(=O)N(N)C(N(N)C(=O)c1ccccc1C(=O)NN)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H18F6N8O4/c20-18(21,22)17(19(23,24)25,32(28)15(36)11-7-3-1-5-9(11)13(34)30-26)33(29)16(37)12-8-4-2-6-10(12)14(35)31-27/h1-8H,26-29H2,(H,30,34)(H,31,35) |
| InChIKey | QDHULSMDIWDOLZ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 202.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.39 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|