C21H19N7 — CID 54222216
6-phenyl-2-N,4-N-bis(pyridin-2-ylmethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 54222216) has the molecular formula C21H19N7 and a molecular weight of 369.43 g/mol. Its IUPAC name is 6-phenyl-2-N,4-N-bis(pyridin-2-ylmethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-phenyl-2-N,4-N-bis(pyridin-2-ylmethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 54222216 |
| Molecular Formula | C21H19N7 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 6-phenyl-2-N,4-N-bis(pyridin-2-ylmethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | c1ccc(-c2nc(NCc3ccccn3)nc(NCc3ccccn3)n2)cc1 |
| InChI | InChI=1S/C21H19N7/c1-2-8-16(9-3-1)19-26-20(24-14-17-10-4-6-12-22-17)28-21(27-19)25-15-18-11-5-7-13-23-18/h1-13H,14-15H2,(H2,24,25,26,27,28) |
| InChIKey | QDKAIWWSNKADTM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |