C12H23N3O6 — CID 54222441
4,4,6,6-tetramethyl-1,2-dinitro-2-(nitromethyl)heptane (PubChem CID 54222441) has the molecular formula C12H23N3O6 and a molecular weight of 305.33 g/mol. Its IUPAC name is 4,4,6,6-tetramethyl-1,2-dinitro-2-(nitromethyl)heptane.
| Compound Name | 4,4,6,6-tetramethyl-1,2-dinitro-2-(nitromethyl)heptane |
|---|---|
| PubChem CID | 54222441 |
| Molecular Formula | C12H23N3O6 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 4,4,6,6-tetramethyl-1,2-dinitro-2-(nitromethyl)heptane |
| SMILES | CC(C)(C)CC(C)(C)CC(C[N+](=O)[O-])(C[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C12H23N3O6/c1-10(2,3)6-11(4,5)7-12(15(20)21,8-13(16)17)9-14(18)19/h6-9H2,1-5H3 |
| InChIKey | QDNQVNFEDKCOPO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|