About pyrimido[1,2-b][2]benzazepine
pyrimido[1,2-b][2]benzazepine (PubChem CID 54222472) has the molecular formula C13H10N2
and a molecular weight of 194.24 g/mol. Its IUPAC name is pyrimido[1,2-b][2]benzazepine.
Molecular Properties
| Compound Name | pyrimido[1,2-b][2]benzazepine |
| PubChem CID | 54222472 |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | pyrimido[1,2-b][2]benzazepine |
| SMILES | C1=CN2C=c3ccccc3=CC=C2N=C1 |
| InChI | InChI=1S/C13H10N2/c1-2-5-12-10-15-9-3-8-14-13(15)7-6-11(12)4-1/h1-10H |
| InChIKey | QDOHCFVNYGMXON-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrimido[1,2-b][2]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimido[1,2-b][2]benzazepine?
The IUPAC name of pyrimido[1,2-b][2]benzazepine (CID 54222472) is pyrimido[1,2-b][2]benzazepine.
What is the SMILES notation for pyrimido[1,2-b][2]benzazepine?
The canonical SMILES for pyrimido[1,2-b][2]benzazepine is C1=CN2C=c3ccccc3=CC=C2N=C1.
What is the InChIKey of pyrimido[1,2-b][2]benzazepine?
The InChIKey is QDOHCFVNYGMXON-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2/c1-2-5-12-10-15-9-3-8-14-13(15)7-6-11(12)4-1/h1-10H.
What are the key properties of pyrimido[1,2-b][2]benzazepine?
pyrimido[1,2-b][2]benzazepine has a molecular weight of 194.24 g/mol, XLogP of 0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimido[1,2-b][2]benzazepine is sourced from PubChem (CID 54222472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).