About CID 54222867
CID 54222867 (PubChem CID 54222867) has the molecular formula C12H23Si
and a molecular weight of 195.40 g/mol.
Molecular Properties
| Compound Name | CID 54222867 |
| PubChem CID | 54222867 |
| Molecular Formula | C12H23Si |
| Molecular Weight | 195.40 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | — |
| SMILES | CC1=CCC(C(C)C[Si](C)C)CC1 |
| InChI | InChI=1S/C12H23Si/c1-10-5-7-12(8-6-10)11(2)9-13(3)4/h5,11-12H,6-9H2,1-4H3 |
| InChIKey | QDVCGPZKLODZHC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 54222867 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 54222867?
The IUPAC name of CID 54222867 (CID 54222867) is not available.
What is the SMILES notation for CID 54222867?
The canonical SMILES for CID 54222867 is CC1=CCC(C(C)C[Si](C)C)CC1.
What is the InChIKey of CID 54222867?
The InChIKey is QDVCGPZKLODZHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23Si/c1-10-5-7-12(8-6-10)11(2)9-13(3)4/h5,11-12H,6-9H2,1-4H3.
What are the key properties of CID 54222867?
CID 54222867 has a molecular weight of 195.40 g/mol, XLogP of 4.12, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 54222867 is sourced from PubChem (CID 54222867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).