C14H18O — CID 54223543
1,3,9-trimethyltricyclo[5.3.1.03,8]undeca-5,9-dien-2-one (PubChem CID 54223543) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 1,3,9-trimethyltricyclo[5.3.1.03,8]undeca-5,9-dien-2-one.
| Compound Name | 1,3,9-trimethyltricyclo[5.3.1.03,8]undeca-5,9-dien-2-one |
|---|---|
| PubChem CID | 54223543 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1,3,9-trimethyltricyclo[5.3.1.03,8]undeca-5,9-dien-2-one |
| SMILES | CC1=CC2(C)CC3C=CCC(C)(C2=O)C13 |
| InChI | InChI=1S/C14H18O/c1-9-7-13(2)8-10-5-4-6-14(3,11(9)10)12(13)15/h4-5,7,10-11H,6,8H2,1-3H3 |
| InChIKey | QEGZXFXVJSPVFK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|